C21H11F17O3S2 — CID 139886138
benzhydrylsulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 139886138) has the molecular formula C21H11F17O3S2 and a molecular weight of 698.42 g/mol. Its IUPAC name is benzhydrylsulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | benzhydrylsulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 139886138 |
| Molecular Formula | C21H11F17O3S2 |
| Molecular Weight | 698.42 g/mol |
| Exact Mass | 697.99 |
| IUPAC Name | benzhydrylsulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)(OSC(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H11F17O3S2/c22-14(23,16(26,27)18(30,31)20(34,35)36)15(24,25)17(28,29)19(32,33)21(37,38)43(39,40)41-42-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | XJYXRQKSAKEIET-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.42 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|