C12H11F9O3SSi — CID 15666297
[dimethyl(phenyl)silyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 15666297) has the molecular formula C12H11F9O3SSi and a molecular weight of 434.35 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [dimethyl(phenyl)silyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 15666297 |
| Molecular Formula | C12H11F9O3SSi |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | [dimethyl(phenyl)silyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | C[Si](C)(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H11F9O3SSi/c1-26(2,8-6-4-3-5-7-8)24-25(22,23)12(20,21)10(15,16)9(13,14)11(17,18)19/h3-7H,1-2H3 |
| InChIKey | VYCDBRCNDRRYET-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|