C23H19F8IO5S2 — CID 159275388
(2-fluorophenyl)-(2,4,6-trimethylphenyl)iodanium;1-fluoro-2-(trifluoromethylsulfonyl)benzene;trifluoromethanesulfonate (PubChem CID 159275388) has the molecular formula C23H19F8IO5S2 and a molecular weight of 718.42 g/mol. Its IUPAC name is (2-fluorophenyl)-(2,4,6-trimethylphenyl)iodanium;1-fluoro-2-(trifluoromethylsulfonyl)benzene;trifluoromethanesulfonate.
| Compound Name | (2-fluorophenyl)-(2,4,6-trimethylphenyl)iodanium;1-fluoro-2-(trifluoromethylsulfonyl)benzene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159275388 |
| Molecular Formula | C23H19F8IO5S2 |
| Molecular Weight | 718.42 g/mol |
| Exact Mass | 717.96 |
| IUPAC Name | (2-fluorophenyl)-(2,4,6-trimethylphenyl)iodanium;1-fluoro-2-(trifluoromethylsulfonyl)benzene;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c([I+]c2ccccc2F)c(C)c1.O=S(=O)([O-])C(F)(F)F.O=S(=O)(c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C15H15FI.C7H4F4O2S.CHF3O3S/c1-10-8-11(2)15(12(3)9-10)17-14-7-5-4-6-13(14)16;8-5-3-1-2-4-6(5)14(12,13)7(9,10)11;2-1(3,4)8(5,6)7/h4-9H,1-3H3;1-4H;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | KYFXEEDLGZYNPN-UHFFFAOYSA-M |
| XLogP | 3.05 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|