C17H17ClF3IO4S — CID 175669123
(3-chloro-4-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate (PubChem CID 175669123) has the molecular formula C17H17ClF3IO4S and a molecular weight of 536.74 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate.
| Compound Name | (3-chloro-4-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175669123 |
| Molecular Formula | C17H17ClF3IO4S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate |
| SMILES | COc1ccc([I+]c2c(C)cc(C)cc2C)cc1Cl.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H17ClIO.CHF3O3S/c1-10-7-11(2)16(12(3)8-10)18-13-5-6-15(19-4)14(17)9-13;2-1(3,4)8(5,6)7/h5-9H,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | OONUFRNDVPBRMS-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|