C15H14F3IO5S — CID 175669103
bis(3-methoxyphenyl)iodanium;trifluoromethanesulfonate (PubChem CID 175669103) has the molecular formula C15H14F3IO5S and a molecular weight of 490.24 g/mol. Its IUPAC name is bis(3-methoxyphenyl)iodanium;trifluoromethanesulfonate.
| Compound Name | bis(3-methoxyphenyl)iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175669103 |
| Molecular Formula | C15H14F3IO5S |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | bis(3-methoxyphenyl)iodanium;trifluoromethanesulfonate |
| SMILES | COc1cccc([I+]c2cccc(OC)c2)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H14IO2.CHF3O3S/c1-16-13-7-3-5-11(9-13)15-12-6-4-8-14(10-12)17-2;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GYRMMZNUCBHDDT-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|