C14H15IO5S — CID 160869400
hydroxy-(3-methoxyphenyl)iodanium;4-methylbenzenesulfonate (PubChem CID 160869400) has the molecular formula C14H15IO5S and a molecular weight of 422.24 g/mol. Its IUPAC name is hydroxy-(3-methoxyphenyl)iodanium;4-methylbenzenesulfonate.
| Compound Name | hydroxy-(3-methoxyphenyl)iodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 160869400 |
| Molecular Formula | C14H15IO5S |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | hydroxy-(3-methoxyphenyl)iodanium;4-methylbenzenesulfonate |
| SMILES | COc1cccc([I+]O)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8IO2.C7H8O3S/c1-10-7-4-2-3-6(5-7)8-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,9H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | SLOFWNGDXFZDGJ-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|