C16H18IO+ — CID 73293132
(3-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium (PubChem CID 73293132) has the molecular formula C16H18IO+ and a molecular weight of 353.22 g/mol. Its IUPAC name is (3-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium.
| Compound Name | (3-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium |
|---|---|
| PubChem CID | 73293132 |
| Molecular Formula | C16H18IO+ |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | (3-methoxyphenyl)-(2,4,6-trimethylphenyl)iodanium |
| SMILES | COc1cccc([I+]c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C16H18IO/c1-11-8-12(2)16(13(3)9-11)17-14-6-5-7-15(10-14)18-4/h5-10H,1-4H3/q+1 |
| InChIKey | NNQUWLQXYQMONO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|