C20H19IO4S — CID 10528781
(3-methoxyphenyl)-phenyliodanium;4-methylbenzenesulfonate (PubChem CID 10528781) has the molecular formula C20H19IO4S and a molecular weight of 482.34 g/mol. Its IUPAC name is (3-methoxyphenyl)-phenyliodanium;4-methylbenzenesulfonate.
| Compound Name | (3-methoxyphenyl)-phenyliodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10528781 |
| Molecular Formula | C20H19IO4S |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | (3-methoxyphenyl)-phenyliodanium;4-methylbenzenesulfonate |
| SMILES | COc1cccc([I+]c2ccccc2)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H12IO.C7H8O3S/c1-15-13-9-5-8-12(10-13)14-11-6-3-2-4-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-10H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | YMCRAVHNOBTCPH-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|