C24H27IO6S — CID 172779485
[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenyliodanium;4-methylbenzenesulfonate (PubChem CID 172779485) has the molecular formula C24H27IO6S and a molecular weight of 570.45 g/mol. Its IUPAC name is [4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenyliodanium;4-methylbenzenesulfonate.
| Compound Name | [4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenyliodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172779485 |
| Molecular Formula | C24H27IO6S |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | [4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenyliodanium;4-methylbenzenesulfonate |
| SMILES | COCCOCCOc1ccc([I+]c2ccccc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H20IO3.C7H8O3S/c1-19-11-12-20-13-14-21-17-9-7-16(8-10-17)18-15-5-3-2-4-6-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-10H,11-14H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | OBFYRDSCEHFVDM-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|