C18H21O6S- — CID 20595015
4-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]benzenesulfonate (PubChem CID 20595015) has the molecular formula C18H21O6S- and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]benzenesulfonate.
| Compound Name | 4-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]benzenesulfonate |
|---|---|
| PubChem CID | 20595015 |
| Molecular Formula | C18H21O6S- |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]benzenesulfonate |
| SMILES | CCOCCOCCOc1ccc(-c2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H22O6S/c1-2-22-11-12-23-13-14-24-17-7-3-15(4-8-17)16-5-9-18(10-6-16)25(19,20)21/h3-10H,2,11-14H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | QGIBHPYDUKTQRP-UHFFFAOYSA-M |
| XLogP | 2.69 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|