C39H48O10S2 — CID 161121621
tert-butyl 2-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonylacetate;1-(2-ethoxyethoxy)-4-(4-methylsulfonylphenyl)benzene (PubChem CID 161121621) has the molecular formula C39H48O10S2 and a molecular weight of 740.94 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonylacetate;1-(2-ethoxyethoxy)-4-(4-methylsulfonylphenyl)benzene.
| Compound Name | tert-butyl 2-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonylacetate;1-(2-ethoxyethoxy)-4-(4-methylsulfonylphenyl)benzene |
|---|---|
| PubChem CID | 161121621 |
| Molecular Formula | C39H48O10S2 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | tert-butyl 2-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonylacetate;1-(2-ethoxyethoxy)-4-(4-methylsulfonylphenyl)benzene |
| SMILES | CCOCCOc1ccc(-c2ccc(S(=O)(=O)CC(=O)OC(C)(C)C)cc2)cc1.CCOCCOc1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H28O6S.C17H20O4S/c1-5-26-14-15-27-19-10-6-17(7-11-19)18-8-12-20(13-9-18)29(24,25)16-21(23)28-22(2,3)4;1-3-20-12-13-21-16-8-4-14(5-9-16)15-6-10-17(11-7-15)22(2,18)19/h6-13H,5,14-16H2,1-4H3;4-11H,3,12-13H2,1-2H3 |
| InChIKey | ULAHWVLQLZRVTA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|