C24H31NO5S2 — CID 142845849
4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonyl-1-ethylpiperidine-4-carbothioic S-acid (PubChem CID 142845849) has the molecular formula C24H31NO5S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonyl-1-ethylpiperidine-4-carbothioic S-acid.
| Compound Name | 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonyl-1-ethylpiperidine-4-carbothioic S-acid |
|---|---|
| PubChem CID | 142845849 |
| Molecular Formula | C24H31NO5S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfonyl-1-ethylpiperidine-4-carbothioic S-acid |
| SMILES | CCOCCOc1ccc(-c2ccc(S(=O)(=O)C3(C(=O)S)CCN(CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H31NO5S2/c1-3-25-15-13-24(14-16-25,23(26)31)32(27,28)22-11-7-20(8-12-22)19-5-9-21(10-6-19)30-18-17-29-4-2/h5-12H,3-4,13-18H2,1-2H3,(H,26,31) |
| InChIKey | CBJHQEDAPRCODJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|