C21H25NO6S — CID 11048042
4-(4-methoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-4-carboxylic acid (PubChem CID 11048042) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11048042 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-4-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)C2(C(=O)O)CCN(CCOc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H25NO6S/c1-27-17-7-9-19(10-8-17)29(25,26)21(20(23)24)11-13-22(14-12-21)15-16-28-18-5-3-2-4-6-18/h2-10H,11-16H2,1H3,(H,23,24) |
| InChIKey | AEMURECWAJLPNX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |