C17H25NO5S — CID 11132010
ethyl 1-ethyl-4-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 11132010) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is ethyl 1-ethyl-4-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-ethyl-4-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 11132010 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | ethyl 1-ethyl-4-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(S(=O)(=O)c2ccc(OC)cc2)CCN(CC)CC1 |
| InChI | InChI=1S/C17H25NO5S/c1-4-18-12-10-17(11-13-18,16(19)23-5-2)24(20,21)15-8-6-14(22-3)7-9-15/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | YJKSGYFKCIWOGH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |