C23H25NO4S2 — CID 11604680
ethyl 4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidine-4-carboxylate (PubChem CID 11604680) has the molecular formula C23H25NO4S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is ethyl 4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidine-4-carboxylate.
| Compound Name | ethyl 4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 11604680 |
| Molecular Formula | C23H25NO4S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl 4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidine-4-carboxylate |
| SMILES | C#CCN1CCC(C(=O)OCC)(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H25NO4S2/c1-3-16-24-17-14-23(15-18-24,22(25)28-4-2)30(26,27)21-12-10-20(11-13-21)29-19-8-6-5-7-9-19/h1,5-13H,4,14-18H2,2H3 |
| InChIKey | MCGJYCIWMHOZET-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|