C22H23NO4S2 — CID 162254368
2-hydroxy-1-[4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone (PubChem CID 162254368) has the molecular formula C22H23NO4S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone.
| Compound Name | 2-hydroxy-1-[4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 162254368 |
| Molecular Formula | C22H23NO4S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-hydroxy-1-[4-(4-phenylsulfanylphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone |
| SMILES | C#CCN1CCC(C(=O)CO)(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H23NO4S2/c1-2-14-23-15-12-22(13-16-23,21(25)17-24)29(26,27)20-10-8-19(9-11-20)28-18-6-4-3-5-7-18/h1,3-11,24H,12-17H2 |
| InChIKey | BOOSQRMACOCVKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|