C26H26ClNO5S — CID 162254369
1-[1-benzyl-4-[4-(4-chlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-2-hydroxyethanone (PubChem CID 162254369) has the molecular formula C26H26ClNO5S and a molecular weight of 500.02 g/mol. Its IUPAC name is 1-[1-benzyl-4-[4-(4-chlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-2-hydroxyethanone.
| Compound Name | 1-[1-benzyl-4-[4-(4-chlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 162254369 |
| Molecular Formula | C26H26ClNO5S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-[1-benzyl-4-[4-(4-chlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)C1(S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H26ClNO5S/c27-21-6-8-22(9-7-21)33-23-10-12-24(13-11-23)34(31,32)26(25(30)19-29)14-16-28(17-15-26)18-20-4-2-1-3-5-20/h1-13,29H,14-19H2 |
| InChIKey | HBPATJWKGZBTFK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |