C26H35NO5S — CID 10906839
ethyl 1-benzyl-4-[4-(3-methylbutoxy)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 10906839) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[4-(3-methylbutoxy)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-benzyl-4-[4-(3-methylbutoxy)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 10906839 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | ethyl 1-benzyl-4-[4-(3-methylbutoxy)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(S(=O)(=O)c2ccc(OCCC(C)C)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35NO5S/c1-4-31-25(28)26(15-17-27(18-16-26)20-22-8-6-5-7-9-22)33(29,30)24-12-10-23(11-13-24)32-19-14-21(2)3/h5-13,21H,4,14-20H2,1-3H3 |
| InChIKey | FLHXAGJEFNGPIJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |