C24H31NO6S — CID 10994203
4-(4-butoxyphenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 10994203) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 4-(4-butoxyphenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 10994203 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-(4-butoxyphenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)C2(C(=O)O)CCN(Cc3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C24H31NO6S/c1-3-4-16-31-20-8-10-22(11-9-20)32(28,29)24(23(26)27)12-14-25(15-13-24)18-19-6-5-7-21(17-19)30-2/h5-11,17H,3-4,12-16,18H2,1-2H3,(H,26,27) |
| InChIKey | BMSJRRAZNLUPNG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|