C22H23NO4S — CID 59966526
1-[4-(3-phenoxyphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone (PubChem CID 59966526) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[4-(3-phenoxyphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone.
| Compound Name | 1-[4-(3-phenoxyphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 59966526 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-[4-(3-phenoxyphenyl)sulfonyl-1-prop-2-ynylpiperidin-4-yl]ethanone |
| SMILES | C#CCN1CCC(C(C)=O)(S(=O)(=O)c2cccc(Oc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H23NO4S/c1-3-14-23-15-12-22(13-16-23,18(2)24)28(25,26)21-11-7-10-20(17-21)27-19-8-5-4-6-9-19/h1,4-11,17H,12-16H2,2H3 |
| InChIKey | BTDGHPIHUCZMAT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|