C19H23N3O5S — CID 22985853
N-hydroxy-1,3-dimethyl-5-(3-phenoxyphenyl)sulfonyl-1,3-diazinane-5-carboxamide (PubChem CID 22985853) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-hydroxy-1,3-dimethyl-5-(3-phenoxyphenyl)sulfonyl-1,3-diazinane-5-carboxamide.
| Compound Name | N-hydroxy-1,3-dimethyl-5-(3-phenoxyphenyl)sulfonyl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 22985853 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-hydroxy-1,3-dimethyl-5-(3-phenoxyphenyl)sulfonyl-1,3-diazinane-5-carboxamide |
| SMILES | CN1CN(C)CC(C(=O)NO)(S(=O)(=O)c2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C19H23N3O5S/c1-21-12-19(18(23)20-24,13-22(2)14-21)28(25,26)17-10-6-9-16(11-17)27-15-7-4-3-5-8-15/h3-11,24H,12-14H2,1-2H3,(H,20,23) |
| InChIKey | UDSQDYZJIZVRPX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|