C23H26N2O7S — CID 118179857
4-[3-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenoxy]benzoic acid (PubChem CID 118179857) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-[3-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenoxy]benzoic acid.
| Compound Name | 4-[3-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 118179857 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 4-[3-[[3-(hydroxycarbamoyl)-8-azaspiro[4.5]decan-3-yl]sulfonyl]phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2cccc(S(=O)(=O)C3(C(=O)NO)CCC4(CCNCC4)C3)c2)cc1 |
| InChI | InChI=1S/C23H26N2O7S/c26-20(27)16-4-6-17(7-5-16)32-18-2-1-3-19(14-18)33(30,31)23(21(28)25-29)9-8-22(15-23)10-12-24-13-11-22/h1-7,14,24,29H,8-13,15H2,(H,25,28)(H,26,27) |
| InChIKey | GJORJAVBYPJRTQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|