C17H23ClN2O5S — CID 118179842
(3S)-3-(3-chloro-4-methoxyphenyl)sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179842) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is (3S)-3-(3-chloro-4-methoxyphenyl)sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-3-(3-chloro-4-methoxyphenyl)sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179842 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (3S)-3-(3-chloro-4-methoxyphenyl)sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)[C@@]2(C(=O)NO)CCC3(CCNCC3)C2)cc1Cl |
| InChI | InChI=1S/C17H23ClN2O5S/c1-25-14-3-2-12(10-13(14)18)26(23,24)17(15(21)20-22)5-4-16(11-17)6-8-19-9-7-16/h2-3,10,19,22H,4-9,11H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | CBBXEXNEWFXPGR-KRWDZBQOSA-N |
| XLogP | 1.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|