C23H26F2N2O6S — CID 118179870
3-[4-[4-(difluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179870) has the molecular formula C23H26F2N2O6S and a molecular weight of 496.53 g/mol. Its IUPAC name is 3-[4-[4-(difluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | 3-[4-[4-(difluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179870 |
| Molecular Formula | C23H26F2N2O6S |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-[4-[4-(difluoromethoxy)phenoxy]phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Oc3ccc(OC(F)F)cc3)cc2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C23H26F2N2O6S/c24-21(25)33-18-3-1-16(2-4-18)32-17-5-7-19(8-6-17)34(30,31)23(20(28)27-29)10-9-22(15-23)11-13-26-14-12-22/h1-8,21,26,29H,9-15H2,(H,27,28) |
| InChIKey | JVKDGTTXLCSABF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|