C23H35N3O4S — CID 118179804
3-[4-(cyclohexylmethylamino)phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179804) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-[4-(cyclohexylmethylamino)phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | 3-[4-(cyclohexylmethylamino)phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179804 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 3-[4-(cyclohexylmethylamino)phenyl]sulfonyl-N-hydroxy-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(NCC3CCCCC3)cc2)CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C23H35N3O4S/c27-21(26-28)23(11-10-22(17-23)12-14-24-15-13-22)31(29,30)20-8-6-19(7-9-20)25-16-18-4-2-1-3-5-18/h6-9,18,24-25,28H,1-5,10-17H2,(H,26,27) |
| InChIKey | KHRJSHHVLKJJHY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|