C19H24ClN3O4S — CID 172705888
N-hydroxy-4-[4-(N-methylanilino)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 172705888) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is N-hydroxy-4-[4-(N-methylanilino)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-(N-methylanilino)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172705888 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-hydroxy-4-[4-(N-methylanilino)phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CN(c1ccccc1)c1ccc(S(=O)(=O)C2(C(=O)NO)CCNCC2)cc1.Cl |
| InChI | InChI=1S/C19H23N3O4S.ClH/c1-22(15-5-3-2-4-6-15)16-7-9-17(10-8-16)27(25,26)19(18(23)21-24)11-13-20-14-12-19;/h2-10,20,24H,11-14H2,1H3,(H,21,23);1H |
| InChIKey | DOTQDYWHKBLUES-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|