C18H26N2O6S — CID 20780942
N-hydroxy-4-[4-[methyl(4-oxopentyl)amino]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20780942) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-hydroxy-4-[4-[methyl(4-oxopentyl)amino]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[methyl(4-oxopentyl)amino]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20780942 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-hydroxy-4-[4-[methyl(4-oxopentyl)amino]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CC(=O)CCCN(C)c1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-14(21)4-3-11-20(2)15-5-7-16(8-6-15)27(24,25)18(17(22)19-23)9-12-26-13-10-18/h5-8,23H,3-4,9-13H2,1-2H3,(H,19,22) |
| InChIKey | RZSKFYFAEOYTIU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|