C27H26N2O6S — CID 11755916
N-hydroxy-4-[4-[6-[methyl(prop-2-ynyl)carbamoyl]naphthalen-2-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 11755916) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-hydroxy-4-[4-[6-[methyl(prop-2-ynyl)carbamoyl]naphthalen-2-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[6-[methyl(prop-2-ynyl)carbamoyl]naphthalen-2-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 11755916 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-hydroxy-4-[4-[6-[methyl(prop-2-ynyl)carbamoyl]naphthalen-2-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | C#CCN(C)C(=O)c1ccc2cc(-c3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)ccc2c1 |
| InChI | InChI=1S/C27H26N2O6S/c1-3-14-29(2)25(30)23-7-6-21-17-20(4-5-22(21)18-23)19-8-10-24(11-9-19)36(33,34)27(26(31)28-32)12-15-35-16-13-27/h1,4-11,17-18,32H,12-16H2,2H3,(H,28,31) |
| InChIKey | PIFMRPJSMSEQAF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|