C21H23NO7S — CID 10159973
N-hydroxy-4-[4-(3-oxo-3-phenylpropoxy)phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10159973) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is N-hydroxy-4-[4-(3-oxo-3-phenylpropoxy)phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(3-oxo-3-phenylpropoxy)phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10159973 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-hydroxy-4-[4-(3-oxo-3-phenylpropoxy)phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(CCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO7S/c23-19(16-4-2-1-3-5-16)10-13-29-17-6-8-18(9-7-17)30(26,27)21(20(24)22-25)11-14-28-15-12-21/h1-9,25H,10-15H2,(H,22,24) |
| InChIKey | XVPSLWZACLKCGC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|