C20H22N2O9S — CID 10412225
N-hydroxy-4-[4-[2-(3-nitrophenoxy)ethoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10412225) has the molecular formula C20H22N2O9S and a molecular weight of 466.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[2-(3-nitrophenoxy)ethoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[2-(3-nitrophenoxy)ethoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10412225 |
| Molecular Formula | C20H22N2O9S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-hydroxy-4-[4-[2-(3-nitrophenoxy)ethoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCOc3cccc([N+](=O)[O-])c3)cc2)CCOCC1 |
| InChI | InChI=1S/C20H22N2O9S/c23-19(21-24)20(8-10-29-11-9-20)32(27,28)18-6-4-16(5-7-18)30-12-13-31-17-3-1-2-15(14-17)22(25)26/h1-7,14,24H,8-13H2,(H,21,23) |
| InChIKey | PCOWOWKDBITSDB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|