C22H25IN2O7S — CID 20620705
N-hydroxy-4-[4-[4-(3-iodoanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620705) has the molecular formula C22H25IN2O7S and a molecular weight of 588.42 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(3-iodoanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(3-iodoanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620705 |
| Molecular Formula | C22H25IN2O7S |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | N-hydroxy-4-[4-[4-(3-iodoanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C22H25IN2O7S/c23-16-3-1-4-17(15-16)24-20(26)5-2-12-32-18-6-8-19(9-7-18)33(29,30)22(21(27)25-28)10-13-31-14-11-22/h1,3-4,6-9,15,28H,2,5,10-14H2,(H,24,26)(H,25,27) |
| InChIKey | KDTNIYNAGYWFAL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|