C23H28N2O6S — CID 142186036
4-[4-[4-(3-methylanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142186036) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is 4-[4-[4-(3-methylanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[4-(3-methylanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142186036 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 4-[4-[4-(3-methylanilino)-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)CCCOc2ccc(S(=O)(=O)C3(C(N)=O)CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H28N2O6S/c1-17-4-2-5-18(16-17)25-21(26)6-3-13-31-19-7-9-20(10-8-19)32(28,29)23(22(24)27)11-14-30-15-12-23/h2,4-5,7-10,16H,3,6,11-15H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | BAHJJTNYWKZLSM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|