C25H32N2O6S — CID 142895617
4-[4-[4-oxo-4-(4-propan-2-ylanilino)butoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142895617) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[4-[4-oxo-4-(4-propan-2-ylanilino)butoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[4-oxo-4-(4-propan-2-ylanilino)butoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895617 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-[4-[4-oxo-4-(4-propan-2-ylanilino)butoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)CCCOc2ccc(S(=O)(=O)C3(C(N)=O)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O6S/c1-18(2)19-5-7-20(8-6-19)27-23(28)4-3-15-33-21-9-11-22(12-10-21)34(30,31)25(24(26)29)13-16-32-17-14-25/h5-12,18H,3-4,13-17H2,1-2H3,(H2,26,29)(H,27,28) |
| InChIKey | UKBMMSHPDJGCJX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|