About ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate
ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate (PubChem CID 142895516) has the molecular formula C20H33NO6S
and a molecular weight of 415.55 g/mol. Its IUPAC name is ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate |
| PubChem CID | 142895516 |
| Molecular Formula | C20H33NO6S |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC.CC(C)OC(=O)C1(S(=O)(=O)c2ccc(OCCCN)cc2)CCOCC1 |
| InChI | InChI=1S/C18H27NO6S.C2H6/c1-14(2)25-17(20)18(8-12-23-13-9-18)26(21,22)16-6-4-15(5-7-16)24-11-3-10-19;1-2/h4-7,14H,3,8-13,19H2,1-2H3;1-2H3 |
| InChIKey | VBLVMPSVQNVAOA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate?
The IUPAC name of ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate (CID 142895516) is ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate?
The canonical SMILES for ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate is CC.CC(C)OC(=O)C1(S(=O)(=O)c2ccc(OCCCN)cc2)CCOCC1.
What is the InChIKey of ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate?
The InChIKey is VBLVMPSVQNVAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO6S.C2H6/c1-14(2)25-17(20)18(8-12-23-13-9-18)26(21,22)16-6-4-15(5-7-16)24-11-3-10-19;1-2/h4-7,14H,3,8-13,19H2,1-2H3;1-2H3.
What are the key properties of ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate?
ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate has a molecular weight of 415.55 g/mol, XLogP of 2.71, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 4-[4-(3-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 142895516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).