C19H29NO6S — CID 20620872
tert-butyl 4-[4-(2-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate (PubChem CID 20620872) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 20620872 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl 4-[4-(2-aminopropoxy)phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC(N)COc1ccc(S(=O)(=O)C2(C(=O)OC(C)(C)C)CCOCC2)cc1 |
| InChI | InChI=1S/C19H29NO6S/c1-14(20)13-25-15-5-7-16(8-6-15)27(22,23)19(9-11-24-12-10-19)17(21)26-18(2,3)4/h5-8,14H,9-13,20H2,1-4H3 |
| InChIKey | REYGQLXSQBHAQP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |