C20H24F6N2O7S — CID 20620304
N-hydroxy-4-[4-[3-[[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl]amino]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620304) has the molecular formula C20H24F6N2O7S and a molecular weight of 550.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl]amino]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-[[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl]amino]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620304 |
| Molecular Formula | C20H24F6N2O7S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | N-hydroxy-4-[4-[3-[[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl]amino]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CC(C(=O)NCCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H24F6N2O7S/c1-17(19(21,22)23,20(24,25)26)15(29)27-9-2-10-35-13-3-5-14(6-4-13)36(32,33)18(16(30)28-31)7-11-34-12-8-18/h3-6,31H,2,7-12H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | FYYQQKSUAXIUBZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|