C23H31ClN2O6S — CID 162309468
N-hydroxy-4-[4-[3-(6-propyl-3-pyridinyl)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 162309468) has the molecular formula C23H31ClN2O6S and a molecular weight of 499.03 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(6-propyl-3-pyridinyl)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[3-(6-propyl-3-pyridinyl)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162309468 |
| Molecular Formula | C23H31ClN2O6S |
| Molecular Weight | 499.03 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-hydroxy-4-[4-[3-(6-propyl-3-pyridinyl)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | CCCc1ccc(CCCOc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cn1.Cl |
| InChI | InChI=1S/C23H30N2O6S.ClH/c1-2-4-19-7-6-18(17-24-19)5-3-14-31-20-8-10-21(11-9-20)32(28,29)23(22(26)25-27)12-15-30-16-13-23;/h6-11,17,27H,2-5,12-16H2,1H3,(H,25,26);1H |
| InChIKey | HGNQOHKQLCKXFW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.03 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|