C21H27ClN2O7S — CID 162305150
N-hydroxy-4-[4-[3-(pyridin-3-ylmethoxy)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 162305150) has the molecular formula C21H27ClN2O7S and a molecular weight of 486.97 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-(pyridin-3-ylmethoxy)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[3-(pyridin-3-ylmethoxy)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162305150 |
| Molecular Formula | C21H27ClN2O7S |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-hydroxy-4-[4-[3-(pyridin-3-ylmethoxy)propoxy]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)c2ccc(OCCCOCc3cccnc3)cc2)CCOCC1 |
| InChI | InChI=1S/C21H26N2O7S.ClH/c24-20(23-25)21(8-13-28-14-9-21)31(26,27)19-6-4-18(5-7-19)30-12-2-11-29-16-17-3-1-10-22-15-17;/h1,3-7,10,15,25H,2,8-9,11-14,16H2,(H,23,24);1H |
| InChIKey | XPTICHDULUQZIF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|