C29H33NO6S — CID 20620448
4-[4-[3-[3-(3,5-dimethylphenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620448) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is 4-[4-[3-[3-(3,5-dimethylphenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(3,5-dimethylphenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620448 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 4-[4-[3-[3-(3,5-dimethylphenyl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | Cc1cc(C)cc(-c2cccc(CCCOc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)c2)c1 |
| InChI | InChI=1S/C29H33NO6S/c1-21-17-22(2)19-25(18-21)24-7-3-5-23(20-24)6-4-14-36-26-8-10-27(11-9-26)37(33,34)29(28(31)30-32)12-15-35-16-13-29/h3,5,7-11,17-20,32H,4,6,12-16H2,1-2H3,(H,30,31) |
| InChIKey | ZWHCJGOQQFMUGR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|