C26H26FNO6S — CID 20620341
4-[4-[2-[3-(2-fluorophenyl)phenyl]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620341) has the molecular formula C26H26FNO6S and a molecular weight of 499.56 g/mol. Its IUPAC name is 4-[4-[2-[3-(2-fluorophenyl)phenyl]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[2-[3-(2-fluorophenyl)phenyl]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620341 |
| Molecular Formula | C26H26FNO6S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[4-[2-[3-(2-fluorophenyl)phenyl]ethoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCc3cccc(-c4ccccc4F)c3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H26FNO6S/c27-24-7-2-1-6-23(24)20-5-3-4-19(18-20)12-15-34-21-8-10-22(11-9-21)35(31,32)26(25(29)28-30)13-16-33-17-14-26/h1-11,18,30H,12-17H2,(H,28,29) |
| InChIKey | OZYDQPWCWDBALU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|