C29H31NO7S — CID 20780929
4-[4-[3-[3-(2,3-dihydro-1-benzofuran-5-yl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20780929) has the molecular formula C29H31NO7S and a molecular weight of 537.63 g/mol. Its IUPAC name is 4-[4-[3-[3-(2,3-dihydro-1-benzofuran-5-yl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(2,3-dihydro-1-benzofuran-5-yl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20780929 |
| Molecular Formula | C29H31NO7S |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 4-[4-[3-[3-(2,3-dihydro-1-benzofuran-5-yl)phenyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCc3cccc(-c4ccc5c(c4)CCO5)c3)cc2)CCOCC1 |
| InChI | InChI=1S/C29H31NO7S/c31-28(30-32)29(13-17-35-18-14-29)38(33,34)26-9-7-25(8-10-26)36-15-2-4-21-3-1-5-22(19-21)23-6-11-27-24(20-23)12-16-37-27/h1,3,5-11,19-20,32H,2,4,12-18H2,(H,30,31) |
| InChIKey | RBRXCYXNZXIRTQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|