C23H26F3NO6S — CID 58623255
4-[4-[4-butoxy-3-(trifluoromethyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 58623255) has the molecular formula C23H26F3NO6S and a molecular weight of 501.52 g/mol. Its IUPAC name is 4-[4-[4-butoxy-3-(trifluoromethyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[4-butoxy-3-(trifluoromethyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 58623255 |
| Molecular Formula | C23H26F3NO6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-[4-[4-butoxy-3-(trifluoromethyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H26F3NO6S/c1-2-3-12-33-20-9-6-17(15-19(20)23(24,25)26)16-4-7-18(8-5-16)34(30,31)22(21(28)27-29)10-13-32-14-11-22/h4-9,15,29H,2-3,10-14H2,1H3,(H,27,28) |
| InChIKey | LRANDYWVXKTSSU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|