C20H27F3N2O6S — CID 142185883
4-[4-[3-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142185883) has the molecular formula C20H27F3N2O6S and a molecular weight of 480.51 g/mol. Its IUPAC name is 4-[4-[3-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142185883 |
| Molecular Formula | C20H27F3N2O6S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-[4-[3-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CC(C)(C(=O)NCCCOc1ccc(S(=O)(=O)C2(C(N)=O)CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O6S/c1-18(2,20(21,22)23)17(27)25-10-3-11-31-14-4-6-15(7-5-14)32(28,29)19(16(24)26)8-12-30-13-9-19/h4-7H,3,8-13H2,1-2H3,(H2,24,26)(H,25,27) |
| InChIKey | AOUKHOKIKDOBNH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|