C25H26F3N3O8S — CID 142895678
4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142895678) has the molecular formula C25H26F3N3O8S and a molecular weight of 585.56 g/mol. Its IUPAC name is 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895678 |
| Molecular Formula | C25H26F3N3O8S |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)(=O)c2ccc(OCCCN3C(=O)CN(c4cccc(OC(F)(F)F)c4)C3=O)cc2)CCOCC1 |
| InChI | InChI=1S/C25H26F3N3O8S/c26-25(27,28)39-19-4-1-3-17(15-19)31-16-21(32)30(23(31)34)11-2-12-38-18-5-7-20(8-6-18)40(35,36)24(22(29)33)9-13-37-14-10-24/h1,3-8,15H,2,9-14,16H2,(H2,29,33) |
| InChIKey | JVJIGBXUVFJMLY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|