C20H27N3O6S — CID 142895819
4-[4-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142895819) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[4-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895819 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[4-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)(=O)c2ccc(CCCCCN3C(=O)CNC3=O)cc2)CCOCC1 |
| InChI | InChI=1S/C20H27N3O6S/c21-18(25)20(9-12-29-13-10-20)30(27,28)16-7-5-15(6-8-16)4-2-1-3-11-23-17(24)14-22-19(23)26/h5-8H,1-4,9-14H2,(H2,21,25)(H,22,26) |
| InChIKey | DERFOHNLCRGCRM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|