C23H36N2O7S2 — CID 142185907
4-[4-[3-(3-ethyl-5-methylpiperidin-1-yl)sulfonylpropoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142185907) has the molecular formula C23H36N2O7S2 and a molecular weight of 516.68 g/mol. Its IUPAC name is 4-[4-[3-(3-ethyl-5-methylpiperidin-1-yl)sulfonylpropoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-(3-ethyl-5-methylpiperidin-1-yl)sulfonylpropoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142185907 |
| Molecular Formula | C23H36N2O7S2 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-[4-[3-(3-ethyl-5-methylpiperidin-1-yl)sulfonylpropoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CCC1CC(C)CN(S(=O)(=O)CCCOc2ccc(S(=O)(=O)C3(C(N)=O)CCOCC3)cc2)C1 |
| InChI | InChI=1S/C23H36N2O7S2/c1-3-19-15-18(2)16-25(17-19)33(27,28)14-4-11-32-20-5-7-21(8-6-20)34(29,30)23(22(24)26)9-12-31-13-10-23/h5-8,18-19H,3-4,9-17H2,1-2H3,(H2,24,26) |
| InChIKey | AKKAXILXVXVZPB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|