C27H38N2O6S — CID 142895923
4-[4-[4-[(5Z,9Z)-4-methyl-1-azacycloundeca-5,9-dien-1-yl]-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 142895923) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is 4-[4-[4-[(5Z,9Z)-4-methyl-1-azacycloundeca-5,9-dien-1-yl]-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | 4-[4-[4-[(5Z,9Z)-4-methyl-1-azacycloundeca-5,9-dien-1-yl]-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895923 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 4-[4-[4-[(5Z,9Z)-4-methyl-1-azacycloundeca-5,9-dien-1-yl]-4-oxobutoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CC1/C=C\CC/C=C\CN(C(=O)CCCOc2ccc(S(=O)(=O)C3(C(N)=O)CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C27H38N2O6S/c1-22-8-5-3-2-4-6-17-29(18-14-22)25(30)9-7-19-35-23-10-12-24(13-11-23)36(32,33)27(26(28)31)15-20-34-21-16-27/h4-6,8,10-13,22H,2-3,7,9,14-21H2,1H3,(H2,28,31)/b6-4-,8-5- |
| InChIKey | KZRSFEKCWOKHBU-VXWIUBPCSA-N |
| XLogP | 3.41 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|