C25H34N4O8S — CID 20620586
N-hydroxy-4-[4-[3-[5-(1-propanoylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 20620586) has the molecular formula C25H34N4O8S and a molecular weight of 550.63 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[5-(1-propanoylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[3-[5-(1-propanoylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 20620586 |
| Molecular Formula | C25H34N4O8S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | N-hydroxy-4-[4-[3-[5-(1-propanoylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]propoxy]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | CCC(=O)N1CCC(c2nnc(CCCOc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)o2)CC1 |
| InChI | InChI=1S/C25H34N4O8S/c1-2-22(30)29-13-9-18(10-14-29)23-27-26-21(37-23)4-3-15-36-19-5-7-20(8-6-19)38(33,34)25(24(31)28-32)11-16-35-17-12-25/h5-8,18,32H,2-4,9-17H2,1H3,(H,28,31) |
| InChIKey | IELTYCPECMCTDV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|