C23H24ClN3O7S — CID 20620465
4-[4-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620465) has the molecular formula C23H24ClN3O7S and a molecular weight of 521.98 g/mol. Its IUPAC name is 4-[4-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620465 |
| Molecular Formula | C23H24ClN3O7S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 4-[4-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCc3nc(-c4ccc(Cl)cc4)no3)cc2)CCOCC1 |
| InChI | InChI=1S/C23H24ClN3O7S/c24-17-5-3-16(4-6-17)21-25-20(34-27-21)2-1-13-33-18-7-9-19(10-8-18)35(30,31)23(22(28)26-29)11-14-32-15-12-23/h3-10,29H,1-2,11-15H2,(H,26,28) |
| InChIKey | AKKHFUMGJSPTFN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|