C25H29F2N4O7S+ — CID 20620425
4-[4-[3-[3-(2,6-difluoro-1-propan-2-ylpyridin-1-ium-4-yl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620425) has the molecular formula C25H29F2N4O7S+ and a molecular weight of 567.59 g/mol. Its IUPAC name is 4-[4-[3-[3-(2,6-difluoro-1-propan-2-ylpyridin-1-ium-4-yl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(2,6-difluoro-1-propan-2-ylpyridin-1-ium-4-yl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620425 |
| Molecular Formula | C25H29F2N4O7S+ |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 4-[4-[3-[3-(2,6-difluoro-1-propan-2-ylpyridin-1-ium-4-yl)-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(C)[n+]1c(F)cc(-c2noc(CCCOc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)n2)cc1F |
| InChI | InChI=1S/C25H28F2N4O7S/c1-16(2)31-20(26)14-17(15-21(31)27)23-28-22(38-30-23)4-3-11-37-18-5-7-19(8-6-18)39(34,35)25(24(32)29-33)9-12-36-13-10-25/h5-8,14-16H,3-4,9-13H2,1-2H3,(H-,29,32,33)/p+1 |
| InChIKey | XQUVRNFJVWYKNT-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|